C17H29NO5Si — CID 53392573
tert-butyl-[1-(2,5-dimethoxyphenyl)-2-nitropropoxy]-dimethylsilane (PubChem CID 53392573) has the molecular formula C17H29NO5Si and a molecular weight of 355.51 g/mol. Its IUPAC name is tert-butyl-[1-(2,5-dimethoxyphenyl)-2-nitropropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-(2,5-dimethoxyphenyl)-2-nitropropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 53392573 |
| Molecular Formula | C17H29NO5Si |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | tert-butyl-[1-(2,5-dimethoxyphenyl)-2-nitropropoxy]-dimethylsilane |
| SMILES | COc1ccc(OC)c(C(O[Si](C)(C)C(C)(C)C)C(C)[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H29NO5Si/c1-12(18(19)20)16(23-24(7,8)17(2,3)4)14-11-13(21-5)9-10-15(14)22-6/h9-12,16H,1-8H3 |
| InChIKey | WLAYWMFSOUAWPA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|