C23H33NO4Si — CID 10432023
tert-butyl-[4-(2,6-dimethyl-4-nitrophenoxy)-2-propan-2-ylphenoxy]-dimethylsilane (PubChem CID 10432023) has the molecular formula C23H33NO4Si and a molecular weight of 415.61 g/mol. Its IUPAC name is tert-butyl-[4-(2,6-dimethyl-4-nitrophenoxy)-2-propan-2-ylphenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-(2,6-dimethyl-4-nitrophenoxy)-2-propan-2-ylphenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10432023 |
| Molecular Formula | C23H33NO4Si |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | tert-butyl-[4-(2,6-dimethyl-4-nitrophenoxy)-2-propan-2-ylphenoxy]-dimethylsilane |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1Oc1ccc(O[Si](C)(C)C(C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C23H33NO4Si/c1-15(2)20-14-19(10-11-21(20)28-29(8,9)23(5,6)7)27-22-16(3)12-18(24(25)26)13-17(22)4/h10-15H,1-9H3 |
| InChIKey | CLKHQJGSYIGZGM-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|