C17H17Cl2NO4 — CID 25180784
2-(3-butan-2-yl-4-methoxyphenoxy)-1,3-dichloro-5-nitrobenzene (PubChem CID 25180784) has the molecular formula C17H17Cl2NO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is 2-(3-butan-2-yl-4-methoxyphenoxy)-1,3-dichloro-5-nitrobenzene.
| Compound Name | 2-(3-butan-2-yl-4-methoxyphenoxy)-1,3-dichloro-5-nitrobenzene |
|---|---|
| PubChem CID | 25180784 |
| Molecular Formula | C17H17Cl2NO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-(3-butan-2-yl-4-methoxyphenoxy)-1,3-dichloro-5-nitrobenzene |
| SMILES | CCC(C)c1cc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)ccc1OC |
| InChI | InChI=1S/C17H17Cl2NO4/c1-4-10(2)13-9-12(5-6-16(13)23-3)24-17-14(18)7-11(20(21)22)8-15(17)19/h5-10H,4H2,1-3H3 |
| InChIKey | BZJVSOHEQLCEBB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|