C17H15Cl2NO4 — CID 54523915
(2,6-dichloro-4-nitrophenyl)-(4-methoxy-3-propan-2-ylphenyl)methanone (PubChem CID 54523915) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is (2,6-dichloro-4-nitrophenyl)-(4-methoxy-3-propan-2-ylphenyl)methanone.
| Compound Name | (2,6-dichloro-4-nitrophenyl)-(4-methoxy-3-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 54523915 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (2,6-dichloro-4-nitrophenyl)-(4-methoxy-3-propan-2-ylphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2c(Cl)cc([N+](=O)[O-])cc2Cl)cc1C(C)C |
| InChI | InChI=1S/C17H15Cl2NO4/c1-9(2)12-6-10(4-5-15(12)24-3)17(21)16-13(18)7-11(20(22)23)8-14(16)19/h4-9H,1-3H3 |
| InChIKey | YRTSLDKULXLMQU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|