C16H15Cl2NO4 — CID 91056227
1,3-dichloro-2-(4-methoxy-3-propan-2-ylphenoxy)-4-nitrobenzene (PubChem CID 91056227) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.21 g/mol. Its IUPAC name is 1,3-dichloro-2-(4-methoxy-3-propan-2-ylphenoxy)-4-nitrobenzene.
| Compound Name | 1,3-dichloro-2-(4-methoxy-3-propan-2-ylphenoxy)-4-nitrobenzene |
|---|---|
| PubChem CID | 91056227 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 1,3-dichloro-2-(4-methoxy-3-propan-2-ylphenoxy)-4-nitrobenzene |
| SMILES | COc1ccc(Oc2c(Cl)ccc([N+](=O)[O-])c2Cl)cc1C(C)C |
| InChI | InChI=1S/C16H15Cl2NO4/c1-9(2)11-8-10(4-7-14(11)22-3)23-16-12(17)5-6-13(15(16)18)19(20)21/h4-9H,1-3H3 |
| InChIKey | GKNXMPNTZYBZPN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|