C23H19Br2NO5 — CID 141017959
[2,4-dibromo-3-(4-methoxy-3-propan-2-ylphenoxy)-6-nitrophenyl]-phenylmethanone (PubChem CID 141017959) has the molecular formula C23H19Br2NO5 and a molecular weight of 549.22 g/mol. Its IUPAC name is [2,4-dibromo-3-(4-methoxy-3-propan-2-ylphenoxy)-6-nitrophenyl]-phenylmethanone.
| Compound Name | [2,4-dibromo-3-(4-methoxy-3-propan-2-ylphenoxy)-6-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 141017959 |
| Molecular Formula | C23H19Br2NO5 |
| Molecular Weight | 549.22 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | [2,4-dibromo-3-(4-methoxy-3-propan-2-ylphenoxy)-6-nitrophenyl]-phenylmethanone |
| SMILES | COc1ccc(Oc2c(Br)cc([N+](=O)[O-])c(C(=O)c3ccccc3)c2Br)cc1C(C)C |
| InChI | InChI=1S/C23H19Br2NO5/c1-13(2)16-11-15(9-10-19(16)30-3)31-23-17(24)12-18(26(28)29)20(21(23)25)22(27)14-7-5-4-6-8-14/h4-13H,1-3H3 |
| InChIKey | MJSIWOJPCCDCIJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.22 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|