C28H30Cl2N2O3 — CID 155781686
[2,4-dichloro-3-(4-methoxy-3-propan-2-ylphenoxy)phenyl]-[4-(4-methylphenyl)piperazin-1-yl]methanone (PubChem CID 155781686) has the molecular formula C28H30Cl2N2O3 and a molecular weight of 513.47 g/mol. Its IUPAC name is [2,4-dichloro-3-(4-methoxy-3-propan-2-ylphenoxy)phenyl]-[4-(4-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [2,4-dichloro-3-(4-methoxy-3-propan-2-ylphenoxy)phenyl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 155781686 |
| Molecular Formula | C28H30Cl2N2O3 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | [2,4-dichloro-3-(4-methoxy-3-propan-2-ylphenoxy)phenyl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(Oc2c(Cl)ccc(C(=O)N3CCN(c4ccc(C)cc4)CC3)c2Cl)cc1C(C)C |
| InChI | InChI=1S/C28H30Cl2N2O3/c1-18(2)23-17-21(9-12-25(23)34-4)35-27-24(29)11-10-22(26(27)30)28(33)32-15-13-31(14-16-32)20-7-5-19(3)6-8-20/h5-12,17-18H,13-16H2,1-4H3 |
| InChIKey | AQMHLHRYKRPGGH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|