C20H21ClN2O3 — CID 2524336
1-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]ethanone (PubChem CID 2524336) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 1-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 2524336 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]ethanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCN(c2ccc(C(C)=O)cc2)CC1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-14(24)15-3-6-17(7-4-15)22-9-11-23(12-10-22)20(25)18-13-16(21)5-8-19(18)26-2/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | GSKZENQYVUTFIG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |