C19H25NO2 — CID 11779514
4-(4-methoxy-3-propan-2-ylphenoxy)-N,3,5-trimethylaniline (PubChem CID 11779514) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 4-(4-methoxy-3-propan-2-ylphenoxy)-N,3,5-trimethylaniline.
| Compound Name | 4-(4-methoxy-3-propan-2-ylphenoxy)-N,3,5-trimethylaniline |
|---|---|
| PubChem CID | 11779514 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 4-(4-methoxy-3-propan-2-ylphenoxy)-N,3,5-trimethylaniline |
| SMILES | CNc1cc(C)c(Oc2ccc(OC)c(C(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C19H25NO2/c1-12(2)17-11-16(7-8-18(17)21-6)22-19-13(3)9-15(20-5)10-14(19)4/h7-12,20H,1-6H3 |
| InChIKey | WNQCKSWUMSJDJX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |