C21H26O3S2 — CID 10000485
O-ethyl [4-(4-methoxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]sulfanylmethanethioate (PubChem CID 10000485) has the molecular formula C21H26O3S2 and a molecular weight of 390.57 g/mol. Its IUPAC name is O-ethyl [4-(4-methoxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]sulfanylmethanethioate.
| Compound Name | O-ethyl [4-(4-methoxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 10000485 |
| Molecular Formula | C21H26O3S2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | O-ethyl [4-(4-methoxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]sulfanylmethanethioate |
| SMILES | CCOC(=S)Sc1cc(C)c(Oc2ccc(OC)c(C(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C21H26O3S2/c1-7-23-21(25)26-17-10-14(4)20(15(5)11-17)24-16-8-9-19(22-6)18(12-16)13(2)3/h8-13H,7H2,1-6H3 |
| InChIKey | IYTNYDABUXRHKE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|