C15H14Cl2N2O4 — CID 164765740
5-(2,6-dichloro-4-nitrophenoxy)-1-methyl-3-propan-2-ylpyridin-2-one (PubChem CID 164765740) has the molecular formula C15H14Cl2N2O4 and a molecular weight of 357.19 g/mol. Its IUPAC name is 5-(2,6-dichloro-4-nitrophenoxy)-1-methyl-3-propan-2-ylpyridin-2-one.
| Compound Name | 5-(2,6-dichloro-4-nitrophenoxy)-1-methyl-3-propan-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 164765740 |
| Molecular Formula | C15H14Cl2N2O4 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 5-(2,6-dichloro-4-nitrophenoxy)-1-methyl-3-propan-2-ylpyridin-2-one |
| SMILES | CC(C)c1cc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)cn(C)c1=O |
| InChI | InChI=1S/C15H14Cl2N2O4/c1-8(2)11-6-10(7-18(3)15(11)20)23-14-12(16)4-9(19(21)22)5-13(14)17/h4-8H,1-3H3 |
| InChIKey | PIRGQBPWBKAILN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|