C17H14Cl2N2O4 — CID 156693228
7-(2,6-dichloro-4-nitrophenoxy)-1-methyl-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 156693228) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is 7-(2,6-dichloro-4-nitrophenoxy)-1-methyl-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 7-(2,6-dichloro-4-nitrophenoxy)-1-methyl-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 156693228 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 7-(2,6-dichloro-4-nitrophenoxy)-1-methyl-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CN1C(=O)CCCc2cc(Oc3c(Cl)cc([N+](=O)[O-])cc3Cl)ccc21 |
| InChI | InChI=1S/C17H14Cl2N2O4/c1-20-15-6-5-12(7-10(15)3-2-4-16(20)22)25-17-13(18)8-11(21(23)24)9-14(17)19/h5-9H,2-4H2,1H3 |
| InChIKey | ZYXXDHUHSLJKKX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|