C19H18Cl2N2O3 — CID 175701293
2-(cyclopropylmethyl)-6-(2,6-dichloro-4-nitrophenoxy)-3,4-dihydro-1H-isoquinoline (PubChem CID 175701293) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-6-(2,6-dichloro-4-nitrophenoxy)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(cyclopropylmethyl)-6-(2,6-dichloro-4-nitrophenoxy)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 175701293 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-(cyclopropylmethyl)-6-(2,6-dichloro-4-nitrophenoxy)-3,4-dihydro-1H-isoquinoline |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Oc2ccc3c(c2)CCN(CC2CC2)C3)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N2O3/c20-17-8-15(23(24)25)9-18(21)19(17)26-16-4-3-14-11-22(10-12-1-2-12)6-5-13(14)7-16/h3-4,7-9,12H,1-2,5-6,10-11H2 |
| InChIKey | ZOHJQOOYMGHDKO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|