C22H15Cl2FN2O4 — CID 175207480
6-(2,6-dichloro-4-nitrophenoxy)-2-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-1-carbaldehyde (PubChem CID 175207480) has the molecular formula C22H15Cl2FN2O4 and a molecular weight of 461.28 g/mol. Its IUPAC name is 6-(2,6-dichloro-4-nitrophenoxy)-2-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-1-carbaldehyde.
| Compound Name | 6-(2,6-dichloro-4-nitrophenoxy)-2-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 175207480 |
| Molecular Formula | C22H15Cl2FN2O4 |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 6-(2,6-dichloro-4-nitrophenoxy)-2-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-1-carbaldehyde |
| SMILES | O=CC1c2ccc(Oc3c(Cl)cc([N+](=O)[O-])cc3Cl)cc2CCN1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H15Cl2FN2O4/c23-19-10-16(27(29)30)11-20(24)22(19)31-17-5-6-18-13(9-17)7-8-26(21(18)12-28)15-3-1-14(25)2-4-15/h1-6,9-12,21H,7-8H2 |
| InChIKey | MEBIJAZNTZPZMN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|