C19H20Cl2N2O3 — CID 175219698
6-(4-amino-2,6-dichlorophenoxy)-2-(2-methoxyethyl)-3,4-dihydro-1H-isoquinoline-1-carbaldehyde (PubChem CID 175219698) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is 6-(4-amino-2,6-dichlorophenoxy)-2-(2-methoxyethyl)-3,4-dihydro-1H-isoquinoline-1-carbaldehyde.
| Compound Name | 6-(4-amino-2,6-dichlorophenoxy)-2-(2-methoxyethyl)-3,4-dihydro-1H-isoquinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 175219698 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 6-(4-amino-2,6-dichlorophenoxy)-2-(2-methoxyethyl)-3,4-dihydro-1H-isoquinoline-1-carbaldehyde |
| SMILES | COCCN1CCc2cc(Oc3c(Cl)cc(N)cc3Cl)ccc2C1C=O |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-25-7-6-23-5-4-12-8-14(2-3-15(12)18(23)11-24)26-19-16(20)9-13(22)10-17(19)21/h2-3,8-11,18H,4-7,22H2,1H3 |
| InChIKey | HSHOZQBNUSNWRM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|