C23H17Cl2F3N2O2 — CID 169001978
6-(4-amino-2,6-dichlorophenoxy)-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 169001978) has the molecular formula C23H17Cl2F3N2O2 and a molecular weight of 481.30 g/mol. Its IUPAC name is 6-(4-amino-2,6-dichlorophenoxy)-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-(4-amino-2,6-dichlorophenoxy)-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 169001978 |
| Molecular Formula | C23H17Cl2F3N2O2 |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 6-(4-amino-2,6-dichlorophenoxy)-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | Nc1cc(Cl)c(Oc2ccc3c(c2)CCN(Cc2ccc(C(F)(F)F)cc2)C3=O)c(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2F3N2O2/c24-19-10-16(29)11-20(25)21(19)32-17-5-6-18-14(9-17)7-8-30(22(18)31)12-13-1-3-15(4-2-13)23(26,27)28/h1-6,9-11H,7-8,12,29H2 |
| InChIKey | WZMQTDGNPVJVIE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|