C27H18Cl2F3N5O6 — CID 174053926
[2-cyano-2-[[3,5-dichloro-4-[[1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]hydrazinylidene]acetyl]carbamic acid (PubChem CID 174053926) has the molecular formula C27H18Cl2F3N5O6 and a molecular weight of 636.37 g/mol. Its IUPAC name is [2-cyano-2-[[3,5-dichloro-4-[[1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]hydrazinylidene]acetyl]carbamic acid.
| Compound Name | [2-cyano-2-[[3,5-dichloro-4-[[1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]hydrazinylidene]acetyl]carbamic acid |
|---|---|
| PubChem CID | 174053926 |
| Molecular Formula | C27H18Cl2F3N5O6 |
| Molecular Weight | 636.37 g/mol |
| Exact Mass | 635.06 |
| IUPAC Name | [2-cyano-2-[[3,5-dichloro-4-[[1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]hydrazinylidene]acetyl]carbamic acid |
| SMILES | N#CC(=NNc1cc(Cl)c(Oc2ccc3c(c2)CCN(Cc2ccc(OC(F)(F)F)cc2)C3=O)c(Cl)c1)C(=O)NC(=O)O |
| InChI | InChI=1S/C27H18Cl2F3N5O6/c28-20-10-16(35-36-22(12-33)24(38)34-26(40)41)11-21(29)23(20)42-18-5-6-19-15(9-18)7-8-37(25(19)39)13-14-1-3-17(4-2-14)43-27(30,31)32/h1-6,9-11,35H,7-8,13H2,(H,34,38)(H,40,41) |
| InChIKey | HWAKIRJWYMHNOZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.37 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|