C21H19Cl2N5O7 — CID 166060545
ethyl 2-[5-[2,6-dichloro-4-[2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]phenoxy]-2-oxo-1-pyridinyl]acetate (PubChem CID 166060545) has the molecular formula C21H19Cl2N5O7 and a molecular weight of 524.32 g/mol. Its IUPAC name is ethyl 2-[5-[2,6-dichloro-4-[2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]phenoxy]-2-oxo-1-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-[2,6-dichloro-4-[2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]phenoxy]-2-oxo-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 166060545 |
| Molecular Formula | C21H19Cl2N5O7 |
| Molecular Weight | 524.32 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | ethyl 2-[5-[2,6-dichloro-4-[2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]phenoxy]-2-oxo-1-pyridinyl]acetate |
| SMILES | CCOC(=O)Cn1cc(Oc2c(Cl)cc(NN=C(C#N)C(=O)NC(=O)OCC)cc2Cl)ccc1=O |
| InChI | InChI=1S/C21H19Cl2N5O7/c1-3-33-18(30)11-28-10-13(5-6-17(28)29)35-19-14(22)7-12(8-15(19)23)26-27-16(9-24)20(31)25-21(32)34-4-2/h5-8,10,26H,3-4,11H2,1-2H3,(H,25,31,32) |
| InChIKey | XNRDRYNHVBSMTA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|