C22H17Cl2N5O4 — CID 156644776
ethyl N-[(2E)-2-cyano-2-[[3,5-dichloro-4-(4-methylquinolin-6-yl)oxyphenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 156644776) has the molecular formula C22H17Cl2N5O4 and a molecular weight of 486.32 g/mol. Its IUPAC name is ethyl N-[(2E)-2-cyano-2-[[3,5-dichloro-4-(4-methylquinolin-6-yl)oxyphenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[(2E)-2-cyano-2-[[3,5-dichloro-4-(4-methylquinolin-6-yl)oxyphenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 156644776 |
| Molecular Formula | C22H17Cl2N5O4 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | ethyl N-[(2E)-2-cyano-2-[[3,5-dichloro-4-(4-methylquinolin-6-yl)oxyphenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=N/Nc1cc(Cl)c(Oc2ccc3nccc(C)c3c2)c(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2N5O4/c1-3-32-22(31)27-21(30)19(11-25)29-28-13-8-16(23)20(17(24)9-13)33-14-4-5-18-15(10-14)12(2)6-7-26-18/h4-10,28H,3H2,1-2H3,(H,27,30,31)/b29-19+ |
| InChIKey | FXYXDDGFTYTHAE-VUTHCHCSSA-N |
| XLogP | 5.21 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|