C22H21ClN6O4 — CID 156644483
ethyl N-[(2E)-2-[[3-chloro-5-ethyl-4-(3-methylbenzimidazol-5-yl)oxyphenyl]hydrazinylidene]-2-cyanoacetyl]carbamate (PubChem CID 156644483) has the molecular formula C22H21ClN6O4 and a molecular weight of 468.90 g/mol. Its IUPAC name is ethyl N-[(2E)-2-[[3-chloro-5-ethyl-4-(3-methylbenzimidazol-5-yl)oxyphenyl]hydrazinylidene]-2-cyanoacetyl]carbamate.
| Compound Name | ethyl N-[(2E)-2-[[3-chloro-5-ethyl-4-(3-methylbenzimidazol-5-yl)oxyphenyl]hydrazinylidene]-2-cyanoacetyl]carbamate |
|---|---|
| PubChem CID | 156644483 |
| Molecular Formula | C22H21ClN6O4 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | ethyl N-[(2E)-2-[[3-chloro-5-ethyl-4-(3-methylbenzimidazol-5-yl)oxyphenyl]hydrazinylidene]-2-cyanoacetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)/C(C#N)=N/Nc1cc(Cl)c(Oc2ccc3ncn(C)c3c2)c(CC)c1 |
| InChI | InChI=1S/C22H21ClN6O4/c1-4-13-8-14(27-28-18(11-24)21(30)26-22(31)32-5-2)9-16(23)20(13)33-15-6-7-17-19(10-15)29(3)12-25-17/h6-10,12,27H,4-5H2,1-3H3,(H,26,30,31)/b28-18+ |
| InChIKey | SCGMDLMVXLUZHP-MTDXEUNCSA-N |
| XLogP | 4.15 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|