C28H31Cl2N5O6Si — CID 155637473
ethyl N-[2-cyano-2-[[3,5-dichloro-4-[3-methyl-2-oxo-1-(2-trimethylsilylethoxymethyl)quinolin-6-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 155637473) has the molecular formula C28H31Cl2N5O6Si and a molecular weight of 632.58 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dichloro-4-[3-methyl-2-oxo-1-(2-trimethylsilylethoxymethyl)quinolin-6-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[3-methyl-2-oxo-1-(2-trimethylsilylethoxymethyl)quinolin-6-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 155637473 |
| Molecular Formula | C28H31Cl2N5O6Si |
| Molecular Weight | 632.58 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[3-methyl-2-oxo-1-(2-trimethylsilylethoxymethyl)quinolin-6-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2ccc3c(c2)cc(C)c(=O)n3COCC[Si](C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C28H31Cl2N5O6Si/c1-6-40-28(38)32-26(36)23(15-31)34-33-19-13-21(29)25(22(30)14-19)41-20-7-8-24-18(12-20)11-17(2)27(37)35(24)16-39-9-10-42(3,4)5/h7-8,11-14,33H,6,9-10,16H2,1-5H3,(H,32,36,38) |
| InChIKey | AJYNCVVMHXTCSS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|