C29H29Cl2N5O7 — CID 175847130
tert-butyl 6-[2,6-dichloro-4-[2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]phenoxy]-4-methyl-3,4-dihydro-1H-pyrano[3,4-b]indole-9-carboxylate (PubChem CID 175847130) has the molecular formula C29H29Cl2N5O7 and a molecular weight of 630.49 g/mol. Its IUPAC name is tert-butyl 6-[2,6-dichloro-4-[2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]phenoxy]-4-methyl-3,4-dihydro-1H-pyrano[3,4-b]indole-9-carboxylate.
| Compound Name | tert-butyl 6-[2,6-dichloro-4-[2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]phenoxy]-4-methyl-3,4-dihydro-1H-pyrano[3,4-b]indole-9-carboxylate |
|---|---|
| PubChem CID | 175847130 |
| Molecular Formula | C29H29Cl2N5O7 |
| Molecular Weight | 630.49 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | tert-butyl 6-[2,6-dichloro-4-[2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]phenoxy]-4-methyl-3,4-dihydro-1H-pyrano[3,4-b]indole-9-carboxylate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2ccc3c(c2)c2c(n3C(=O)OC(C)(C)C)COCC2C)c(Cl)c1 |
| InChI | InChI=1S/C29H29Cl2N5O7/c1-6-41-27(38)33-26(37)21(12-32)35-34-16-9-19(30)25(20(31)10-16)42-17-7-8-22-18(11-17)24-15(2)13-40-14-23(24)36(22)28(39)43-29(3,4)5/h7-11,15,34H,6,13-14H2,1-5H3,(H,33,37,38) |
| InChIKey | VKGQQNYSBRPSLU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.49 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|