C18H12BrCl2N5O6 — CID 155637494
ethyl N-[2-[[4-(3-bromo-4-nitrophenoxy)-3,5-dichlorophenyl]hydrazinylidene]-2-cyanoacetyl]carbamate (PubChem CID 155637494) has the molecular formula C18H12BrCl2N5O6 and a molecular weight of 545.13 g/mol. Its IUPAC name is ethyl N-[2-[[4-(3-bromo-4-nitrophenoxy)-3,5-dichlorophenyl]hydrazinylidene]-2-cyanoacetyl]carbamate.
| Compound Name | ethyl N-[2-[[4-(3-bromo-4-nitrophenoxy)-3,5-dichlorophenyl]hydrazinylidene]-2-cyanoacetyl]carbamate |
|---|---|
| PubChem CID | 155637494 |
| Molecular Formula | C18H12BrCl2N5O6 |
| Molecular Weight | 545.13 g/mol |
| Exact Mass | 542.93 |
| IUPAC Name | ethyl N-[2-[[4-(3-bromo-4-nitrophenoxy)-3,5-dichlorophenyl]hydrazinylidene]-2-cyanoacetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2ccc([N+](=O)[O-])c(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C18H12BrCl2N5O6/c1-2-31-18(28)23-17(27)14(8-22)25-24-9-5-12(20)16(13(21)6-9)32-10-3-4-15(26(29)30)11(19)7-10/h3-7,24H,2H2,1H3,(H,23,27,28) |
| InChIKey | OGPCFEQQBHMDBO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 155.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.13 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|