C23H24N4O5 — CID 175787908
ethyl N-[2-cyano-2-[[4-(4-hydroxy-3-prop-1-en-2-ylphenoxy)-3,5-dimethylphenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 175787908) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[4-(4-hydroxy-3-prop-1-en-2-ylphenoxy)-3,5-dimethylphenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[4-(4-hydroxy-3-prop-1-en-2-ylphenoxy)-3,5-dimethylphenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 175787908 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | ethyl N-[2-cyano-2-[[4-(4-hydroxy-3-prop-1-en-2-ylphenoxy)-3,5-dimethylphenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | C=C(C)c1cc(Oc2c(C)cc(NN=C(C#N)C(=O)NC(=O)OCC)cc2C)ccc1O |
| InChI | InChI=1S/C23H24N4O5/c1-6-31-23(30)25-22(29)19(12-24)27-26-16-9-14(4)21(15(5)10-16)32-17-7-8-20(28)18(11-17)13(2)3/h7-11,26,28H,2,6H2,1,3-5H3,(H,25,29,30) |
| InChIKey | ASKJRYMXMYDZIA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|