C25H25N5O5 — CID 163293691
ethyl N-[2-cyano-2-[[3,5-dimethyl-4-(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)oxyphenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 163293691) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dimethyl-4-(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)oxyphenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dimethyl-4-(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)oxyphenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 163293691 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dimethyl-4-(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)oxyphenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(C)c(Oc2ccc3c(c2)C2(CCC2)C(=O)N3)c(C)c1 |
| InChI | InChI=1S/C25H25N5O5/c1-4-34-24(33)28-22(31)20(13-26)30-29-16-10-14(2)21(15(3)11-16)35-17-6-7-19-18(12-17)25(8-5-9-25)23(32)27-19/h6-7,10-12,29H,4-5,8-9H2,1-3H3,(H,27,32)(H,28,31,33) |
| InChIKey | VTLDNWIEURUODE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|