C21H17Cl2N5O5 — CID 170674598
ethyl N-[2-cyano-2-[[3,5-dichloro-4-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 170674598) has the molecular formula C21H17Cl2N5O5 and a molecular weight of 490.30 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dichloro-4-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 170674598 |
| Molecular Formula | C21H17Cl2N5O5 |
| Molecular Weight | 490.30 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)oxy]phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2ccc3c(c2)CCNC3=O)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2N5O5/c1-2-32-21(31)26-20(30)17(10-24)28-27-12-8-15(22)18(16(23)9-12)33-13-3-4-14-11(7-13)5-6-25-19(14)29/h3-4,7-9,27H,2,5-6H2,1H3,(H,25,29)(H,26,30,31) |
| InChIKey | RZFOMNZZLUZCIO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|