C26H18Cl3N5O5 — CID 175922208
[2-cyano-2-[[3,5-dichloro-4-[[2-[(4-chlorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]hydrazinylidene]acetyl]carbamic acid (PubChem CID 175922208) has the molecular formula C26H18Cl3N5O5 and a molecular weight of 586.82 g/mol. Its IUPAC name is [2-cyano-2-[[3,5-dichloro-4-[[2-[(4-chlorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]hydrazinylidene]acetyl]carbamic acid.
| Compound Name | [2-cyano-2-[[3,5-dichloro-4-[[2-[(4-chlorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]hydrazinylidene]acetyl]carbamic acid |
|---|---|
| PubChem CID | 175922208 |
| Molecular Formula | C26H18Cl3N5O5 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 585.04 |
| IUPAC Name | [2-cyano-2-[[3,5-dichloro-4-[[2-[(4-chlorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]hydrazinylidene]acetyl]carbamic acid |
| SMILES | N#CC(=NNc1cc(Cl)c(Oc2ccc3c(c2)CCN(Cc2ccc(Cl)cc2)C3=O)c(Cl)c1)C(=O)NC(=O)O |
| InChI | InChI=1S/C26H18Cl3N5O5/c27-16-3-1-14(2-4-16)13-34-8-7-15-9-18(5-6-19(15)25(34)36)39-23-20(28)10-17(11-21(23)29)32-33-22(12-30)24(35)31-26(37)38/h1-6,9-11,32H,7-8,13H2,(H,31,35)(H,37,38) |
| InChIKey | ORCJPCGUCPMIFU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|