C23H21Cl2N3O3 — CID 162758055
6-(2,6-dichloro-4-hydrazinylphenoxy)-2-[(3-methoxyphenyl)methyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 162758055) has the molecular formula C23H21Cl2N3O3 and a molecular weight of 458.35 g/mol. Its IUPAC name is 6-(2,6-dichloro-4-hydrazinylphenoxy)-2-[(3-methoxyphenyl)methyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-(2,6-dichloro-4-hydrazinylphenoxy)-2-[(3-methoxyphenyl)methyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 162758055 |
| Molecular Formula | C23H21Cl2N3O3 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 6-(2,6-dichloro-4-hydrazinylphenoxy)-2-[(3-methoxyphenyl)methyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1cccc(CN2CCc3cc(Oc4c(Cl)cc(NN)cc4Cl)ccc3C2=O)c1 |
| InChI | InChI=1S/C23H21Cl2N3O3/c1-30-17-4-2-3-14(9-17)13-28-8-7-15-10-18(5-6-19(15)23(28)29)31-22-20(24)11-16(27-26)12-21(22)25/h2-6,9-12,27H,7-8,13,26H2,1H3 |
| InChIKey | SIELCERBXFIVBQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|