C26H16Cl2FN5O4 — CID 169002007
2-[3,5-dichloro-4-[[2-[(3-fluorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 169002007) has the molecular formula C26H16Cl2FN5O4 and a molecular weight of 552.35 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[2-[(3-fluorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[2-[(3-fluorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 169002007 |
| Molecular Formula | C26H16Cl2FN5O4 |
| Molecular Weight | 552.35 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | 2-[3,5-dichloro-4-[[2-[(3-fluorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2cc(Cl)c(Oc3ccc4c(c3)CCN(Cc3cccc(F)c3)C4=O)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H16Cl2FN5O4/c27-20-10-17(34-26(37)31-24(35)22(12-30)32-34)11-21(28)23(20)38-18-4-5-19-15(9-18)6-7-33(25(19)36)13-14-2-1-3-16(29)8-14/h1-5,8-11H,6-7,13H2,(H,31,35,37) |
| InChIKey | AFELGECCNMSJPR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |