C16H8Cl2N5O3Y- — CID 164942915
2-[4-(4-aminobenzene-5-id-1-yl)oxy-3,5-dichlorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;yttrium (PubChem CID 164942915) has the molecular formula C16H8Cl2N5O3Y- and a molecular weight of 478.08 g/mol. Its IUPAC name is 2-[4-(4-aminobenzene-5-id-1-yl)oxy-3,5-dichlorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;yttrium.
| Compound Name | 2-[4-(4-aminobenzene-5-id-1-yl)oxy-3,5-dichlorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;yttrium |
|---|---|
| PubChem CID | 164942915 |
| Molecular Formula | C16H8Cl2N5O3Y- |
| Molecular Weight | 478.08 g/mol |
| Exact Mass | 476.91 |
| IUPAC Name | 2-[4-(4-aminobenzene-5-id-1-yl)oxy-3,5-dichlorophenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;yttrium |
| SMILES | N#Cc1nn(-c2cc(Cl)c(Oc3c[c-]c(N)cc3)c(Cl)c2)c(=O)[nH]c1=O.[Y] |
| InChI | InChI=1S/C16H8Cl2N5O3.Y/c17-11-5-9(23-16(25)21-15(24)13(7-19)22-23)6-12(18)14(11)26-10-3-1-8(20)2-4-10;/h1,3-6H,20H2,(H,21,24,25);/q-1; |
| InChIKey | DIFXLEGXQDPDAX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.08 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|