C24H19Cl2N5O4 — CID 167477370
2-[3,5-dichloro-4-[(1,4,4-trimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 167477370) has the molecular formula C24H19Cl2N5O4 and a molecular weight of 512.35 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(1,4,4-trimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[(1,4,4-trimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 167477370 |
| Molecular Formula | C24H19Cl2N5O4 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | 2-[3,5-dichloro-4-[(1,4,4-trimethyl-3,9-dihydro-1H-pyrano[3,4-b]indol-6-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | CC1OCC(C)(C)c2c1[nH]c1ccc(Oc3c(Cl)cc(-n4nc(C#N)c(=O)[nH]c4=O)cc3Cl)cc21 |
| InChI | InChI=1S/C24H19Cl2N5O4/c1-11-20-19(24(2,3)10-34-11)14-8-13(4-5-17(14)28-20)35-21-15(25)6-12(7-16(21)26)31-23(33)29-22(32)18(9-27)30-31/h4-8,11,28H,10H2,1-3H3,(H,29,32,33) |
| InChIKey | DIADCIHGJAXSEC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |