C18H10Cl2F3N5O4 — CID 175460483
2-[3,5-dichloro-4-[[6-oxo-1-(1,1,3-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 175460483) has the molecular formula C18H10Cl2F3N5O4 and a molecular weight of 488.21 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[6-oxo-1-(1,1,3-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[6-oxo-1-(1,1,3-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 175460483 |
| Molecular Formula | C18H10Cl2F3N5O4 |
| Molecular Weight | 488.21 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 2-[3,5-dichloro-4-[[6-oxo-1-(1,1,3-trifluoropropan-2-yl)-3-pyridinyl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2cc(Cl)c(Oc3ccc(=O)n(C(CF)C(F)F)c3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H10Cl2F3N5O4/c19-10-3-8(28-18(31)25-17(30)12(6-24)26-28)4-11(20)15(10)32-9-1-2-14(29)27(7-9)13(5-21)16(22)23/h1-4,7,13,16H,5H2,(H,25,30,31) |
| InChIKey | DIILGKJDTKZUAF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |