C24H21Cl2N5O5 — CID 170047071
2-[3,5-dichloro-4-[[2-(2-ethoxypropan-2-yl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 170047071) has the molecular formula C24H21Cl2N5O5 and a molecular weight of 530.37 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[2-(2-ethoxypropan-2-yl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[2-(2-ethoxypropan-2-yl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 170047071 |
| Molecular Formula | C24H21Cl2N5O5 |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | 2-[3,5-dichloro-4-[[2-(2-ethoxypropan-2-yl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | CCOC(C)(C)N1CCc2cc(Oc3c(Cl)cc(-n4nc(C#N)c(=O)[nH]c4=O)cc3Cl)ccc2C1=O |
| InChI | InChI=1S/C24H21Cl2N5O5/c1-4-35-24(2,3)30-8-7-13-9-15(5-6-16(13)22(30)33)36-20-17(25)10-14(11-18(20)26)31-23(34)28-21(32)19(12-27)29-31/h5-6,9-11H,4,7-8H2,1-3H3,(H,28,32,34) |
| InChIKey | HSJVYAYGGVGORE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |