C25H17Cl2N5O6 — CID 169002013
2-[3,5-dichloro-4-[[1-oxo-2-(pyridin-4-ylmethyl)-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carboxylic acid (PubChem CID 169002013) has the molecular formula C25H17Cl2N5O6 and a molecular weight of 554.35 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[1-oxo-2-(pyridin-4-ylmethyl)-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carboxylic acid.
| Compound Name | 2-[3,5-dichloro-4-[[1-oxo-2-(pyridin-4-ylmethyl)-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carboxylic acid |
|---|---|
| PubChem CID | 169002013 |
| Molecular Formula | C25H17Cl2N5O6 |
| Molecular Weight | 554.35 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | 2-[3,5-dichloro-4-[[1-oxo-2-(pyridin-4-ylmethyl)-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2cc(Cl)c(Oc3ccc4c(c3)CCN(Cc3ccncc3)C4=O)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H17Cl2N5O6/c26-18-10-15(32-25(37)29-22(33)20(30-32)24(35)36)11-19(27)21(18)38-16-1-2-17-14(9-16)5-8-31(23(17)34)12-13-3-6-28-7-4-13/h1-4,6-7,9-11H,5,8,12H2,(H,35,36)(H,29,33,37) |
| InChIKey | UYVJXQOZPFILCP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 147.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |