C23H18Cl2F3N3O3 — CID 162758028
6-(2,6-dichloro-4-hydrazinylphenoxy)-2-[[4-(trifluoromethoxy)phenyl]methyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 162758028) has the molecular formula C23H18Cl2F3N3O3 and a molecular weight of 512.32 g/mol. Its IUPAC name is 6-(2,6-dichloro-4-hydrazinylphenoxy)-2-[[4-(trifluoromethoxy)phenyl]methyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-(2,6-dichloro-4-hydrazinylphenoxy)-2-[[4-(trifluoromethoxy)phenyl]methyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 162758028 |
| Molecular Formula | C23H18Cl2F3N3O3 |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 6-(2,6-dichloro-4-hydrazinylphenoxy)-2-[[4-(trifluoromethoxy)phenyl]methyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | NNc1cc(Cl)c(Oc2ccc3c(c2)CCN(Cc2ccc(OC(F)(F)F)cc2)C3=O)c(Cl)c1 |
| InChI | InChI=1S/C23H18Cl2F3N3O3/c24-19-10-15(30-29)11-20(25)21(19)33-17-5-6-18-14(9-17)7-8-31(22(18)32)12-13-1-3-16(4-2-13)34-23(26,27)28/h1-6,9-11,30H,7-8,12,29H2 |
| InChIKey | DHECCSUFJVMXRT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|