C17H14Cl2F2N5O4P — CID 163293517
6-amino-2-[3,5-dichloro-4-[[1-(1,1-difluoro-1-phosphanylpropan-2-yl)-6-oxo-3-pyridinyl]oxy]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 163293517) has the molecular formula C17H14Cl2F2N5O4P and a molecular weight of 492.21 g/mol. Its IUPAC name is 6-amino-2-[3,5-dichloro-4-[[1-(1,1-difluoro-1-phosphanylpropan-2-yl)-6-oxo-3-pyridinyl]oxy]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-amino-2-[3,5-dichloro-4-[[1-(1,1-difluoro-1-phosphanylpropan-2-yl)-6-oxo-3-pyridinyl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 163293517 |
| Molecular Formula | C17H14Cl2F2N5O4P |
| Molecular Weight | 492.21 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | 6-amino-2-[3,5-dichloro-4-[[1-(1,1-difluoro-1-phosphanylpropan-2-yl)-6-oxo-3-pyridinyl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | CC(n1cc(Oc2c(Cl)cc(-n3nc(N)c(=O)[nH]c3=O)cc2Cl)ccc1=O)C(F)(F)P |
| InChI | InChI=1S/C17H14Cl2F2N5O4P/c1-7(17(20,21)31)25-6-9(2-3-12(25)27)30-13-10(18)4-8(5-11(13)19)26-16(29)23-15(28)14(22)24-26/h2-7H,31H2,1H3,(H2,22,24)(H,23,28,29) |
| InChIKey | NDISEMZHCAXTBM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|