C27H27Cl2F3N4O3 — CID 155720273
2-[3,5-dichloro-4-[4-methyl-3-[(Z)-1,1,1-trifluoro-2-methylhept-3-en-3-yl]phenoxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;ethane (PubChem CID 155720273) has the molecular formula C27H27Cl2F3N4O3 and a molecular weight of 583.44 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[4-methyl-3-[(Z)-1,1,1-trifluoro-2-methylhept-3-en-3-yl]phenoxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;ethane.
| Compound Name | 2-[3,5-dichloro-4-[4-methyl-3-[(Z)-1,1,1-trifluoro-2-methylhept-3-en-3-yl]phenoxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;ethane |
|---|---|
| PubChem CID | 155720273 |
| Molecular Formula | C27H27Cl2F3N4O3 |
| Molecular Weight | 583.44 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | 2-[3,5-dichloro-4-[4-methyl-3-[(Z)-1,1,1-trifluoro-2-methylhept-3-en-3-yl]phenoxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile;ethane |
| SMILES | CC.CCC/C=C(\c1cc(Oc2c(Cl)cc(-n3nc(C#N)c(=O)[nH]c3=O)cc2Cl)ccc1C)C(C)C(F)(F)F |
| InChI | InChI=1S/C25H21Cl2F3N4O3.C2H6/c1-4-5-6-17(14(3)25(28,29)30)18-11-16(8-7-13(18)2)37-22-19(26)9-15(10-20(22)27)34-24(36)32-23(35)21(12-31)33-34;1-2/h6-11,14H,4-5H2,1-3H3,(H,32,35,36);1-2H3/b17-6-; |
| InChIKey | GVWWDRBSUGUWNF-MHUGMFFYSA-N |
| XLogP | 7.61 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.44 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |