C24H24Cl2N4O4 — CID 155720316
6-amino-2-[3,5-dichloro-4-[4-methyl-3-[(Z)-2-methyl-5-oxohept-3-en-4-yl]phenoxy]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 155720316) has the molecular formula C24H24Cl2N4O4 and a molecular weight of 503.39 g/mol. Its IUPAC name is 6-amino-2-[3,5-dichloro-4-[4-methyl-3-[(Z)-2-methyl-5-oxohept-3-en-4-yl]phenoxy]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-amino-2-[3,5-dichloro-4-[4-methyl-3-[(Z)-2-methyl-5-oxohept-3-en-4-yl]phenoxy]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 155720316 |
| Molecular Formula | C24H24Cl2N4O4 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 6-amino-2-[3,5-dichloro-4-[4-methyl-3-[(Z)-2-methyl-5-oxohept-3-en-4-yl]phenoxy]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | CCC(=O)/C(=C\C(C)C)c1cc(Oc2c(Cl)cc(-n3nc(N)c(=O)[nH]c3=O)cc2Cl)ccc1C |
| InChI | InChI=1S/C24H24Cl2N4O4/c1-5-20(31)17(8-12(2)3)16-11-15(7-6-13(16)4)34-21-18(25)9-14(10-19(21)26)30-24(33)28-23(32)22(27)29-30/h6-12H,5H2,1-4H3,(H2,27,29)(H,28,32,33)/b17-8- |
| InChIKey | GXRQOQMHWLIUTO-IUXPMGMMSA-N |
| XLogP | 4.93 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|