C22H15Cl2F5N4O5 — CID 157410605
5-[2,6-dichloro-4-[3,5-dioxo-6-(trifluoromethyl)-1,2,4-triazin-2-yl]phenoxy]-N-(3,3-difluorocyclobutyl)-2-methoxybenzamide (PubChem CID 157410605) has the molecular formula C22H15Cl2F5N4O5 and a molecular weight of 581.28 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-[3,5-dioxo-6-(trifluoromethyl)-1,2,4-triazin-2-yl]phenoxy]-N-(3,3-difluorocyclobutyl)-2-methoxybenzamide.
| Compound Name | 5-[2,6-dichloro-4-[3,5-dioxo-6-(trifluoromethyl)-1,2,4-triazin-2-yl]phenoxy]-N-(3,3-difluorocyclobutyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 157410605 |
| Molecular Formula | C22H15Cl2F5N4O5 |
| Molecular Weight | 581.28 g/mol |
| Exact Mass | 580.03 |
| IUPAC Name | 5-[2,6-dichloro-4-[3,5-dioxo-6-(trifluoromethyl)-1,2,4-triazin-2-yl]phenoxy]-N-(3,3-difluorocyclobutyl)-2-methoxybenzamide |
| SMILES | COc1ccc(Oc2c(Cl)cc(-n3nc(C(F)(F)F)c(=O)[nH]c3=O)cc2Cl)cc1C(=O)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C22H15Cl2F5N4O5/c1-37-15-3-2-11(6-12(15)18(34)30-9-7-21(25,26)8-9)38-16-13(23)4-10(5-14(16)24)33-20(36)31-19(35)17(32-33)22(27,28)29/h2-6,9H,7-8H2,1H3,(H,30,34)(H,31,35,36) |
| InChIKey | FEPKBQWZDYHTKF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |