C18H16BrCl2NO4 — CID 166666185
5-(4-bromo-2,6-dichlorophenoxy)-2-methoxy-N-(oxolan-3-yl)benzamide (PubChem CID 166666185) has the molecular formula C18H16BrCl2NO4 and a molecular weight of 461.14 g/mol. Its IUPAC name is 5-(4-bromo-2,6-dichlorophenoxy)-2-methoxy-N-(oxolan-3-yl)benzamide.
| Compound Name | 5-(4-bromo-2,6-dichlorophenoxy)-2-methoxy-N-(oxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 166666185 |
| Molecular Formula | C18H16BrCl2NO4 |
| Molecular Weight | 461.14 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | 5-(4-bromo-2,6-dichlorophenoxy)-2-methoxy-N-(oxolan-3-yl)benzamide |
| SMILES | COc1ccc(Oc2c(Cl)cc(Br)cc2Cl)cc1C(=O)NC1CCOC1 |
| InChI | InChI=1S/C18H16BrCl2NO4/c1-24-16-3-2-12(26-17-14(20)6-10(19)7-15(17)21)8-13(16)18(23)22-11-4-5-25-9-11/h2-3,6-8,11H,4-5,9H2,1H3,(H,22,23) |
| InChIKey | WZQSHRRHRUECNB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.14 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |