C11H11BrFNO2 — CID 80713377
4-bromo-2-fluoro-N-(oxolan-3-yl)benzamide (PubChem CID 80713377) has the molecular formula C11H11BrFNO2 and a molecular weight of 288.12 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-(oxolan-3-yl)benzamide.
| Compound Name | 4-bromo-2-fluoro-N-(oxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 80713377 |
| Molecular Formula | C11H11BrFNO2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 4-bromo-2-fluoro-N-(oxolan-3-yl)benzamide |
| SMILES | O=C(NC1CCOC1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H11BrFNO2/c12-7-1-2-9(10(13)5-7)11(15)14-8-3-4-16-6-8/h1-2,5,8H,3-4,6H2,(H,14,15) |
| InChIKey | HOXAFLXNYLSICU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |