C13H13BrN2O2 — CID 172654541
5-bromo-N-(oxolan-3-yl)-1H-indole-3-carboxamide (PubChem CID 172654541) has the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. Its IUPAC name is 5-bromo-N-(oxolan-3-yl)-1H-indole-3-carboxamide.
| Compound Name | 5-bromo-N-(oxolan-3-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 172654541 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 5-bromo-N-(oxolan-3-yl)-1H-indole-3-carboxamide |
| SMILES | O=C(NC1CCOC1)c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C13H13BrN2O2/c14-8-1-2-12-10(5-8)11(6-15-12)13(17)16-9-3-4-18-7-9/h1-2,5-6,9,15H,3-4,7H2,(H,16,17) |
| InChIKey | LLNOWUCYIRMZQD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |