C13H15N3O2 — CID 80717046
6-amino-N-(oxolan-3-yl)-1H-indole-3-carboxamide (PubChem CID 80717046) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-amino-N-(oxolan-3-yl)-1H-indole-3-carboxamide.
| Compound Name | 6-amino-N-(oxolan-3-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 80717046 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 6-amino-N-(oxolan-3-yl)-1H-indole-3-carboxamide |
| SMILES | Nc1ccc2c(C(=O)NC3CCOC3)c[nH]c2c1 |
| InChI | InChI=1S/C13H15N3O2/c14-8-1-2-10-11(6-15-12(10)5-8)13(17)16-9-3-4-18-7-9/h1-2,5-6,9,15H,3-4,7,14H2,(H,16,17) |
| InChIKey | GAGFHTOOLDIDFZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|