C17H23N3O — CID 63993854
6-amino-N-(2,4-dimethylcyclohexyl)-1H-indole-3-carboxamide (PubChem CID 63993854) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 6-amino-N-(2,4-dimethylcyclohexyl)-1H-indole-3-carboxamide.
| Compound Name | 6-amino-N-(2,4-dimethylcyclohexyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 63993854 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 6-amino-N-(2,4-dimethylcyclohexyl)-1H-indole-3-carboxamide |
| SMILES | CC1CCC(NC(=O)c2c[nH]c3cc(N)ccc23)C(C)C1 |
| InChI | InChI=1S/C17H23N3O/c1-10-3-6-15(11(2)7-10)20-17(21)14-9-19-16-8-12(18)4-5-13(14)16/h4-5,8-11,15,19H,3,6-7,18H2,1-2H3,(H,20,21) |
| InChIKey | CBRLYBYYFORXHQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|