C16H19BrN2O — CID 25362200
5-bromo-N-[(1R,2R)-2-methylcyclohexyl]-1H-indole-3-carboxamide (PubChem CID 25362200) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 5-bromo-N-[(1R,2R)-2-methylcyclohexyl]-1H-indole-3-carboxamide.
| Compound Name | 5-bromo-N-[(1R,2R)-2-methylcyclohexyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 25362200 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 5-bromo-N-[(1R,2R)-2-methylcyclohexyl]-1H-indole-3-carboxamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C16H19BrN2O/c1-10-4-2-3-5-14(10)19-16(20)13-9-18-15-7-6-11(17)8-12(13)15/h6-10,14,18H,2-5H2,1H3,(H,19,20)/t10-,14-/m1/s1 |
| InChIKey | UAEYBPUNSDSWRW-QMTHXVAHSA-N |
| XLogP | 4.24 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |