C15H14BrF3N2O2 — CID 172674750
6-bromo-N-(oxolan-3-yl)-1-(2,2,2-trifluoroethyl)indole-3-carboxamide (PubChem CID 172674750) has the molecular formula C15H14BrF3N2O2 and a molecular weight of 391.19 g/mol. Its IUPAC name is 6-bromo-N-(oxolan-3-yl)-1-(2,2,2-trifluoroethyl)indole-3-carboxamide.
| Compound Name | 6-bromo-N-(oxolan-3-yl)-1-(2,2,2-trifluoroethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 172674750 |
| Molecular Formula | C15H14BrF3N2O2 |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 6-bromo-N-(oxolan-3-yl)-1-(2,2,2-trifluoroethyl)indole-3-carboxamide |
| SMILES | O=C(NC1CCOC1)c1cn(CC(F)(F)F)c2cc(Br)ccc12 |
| InChI | InChI=1S/C15H14BrF3N2O2/c16-9-1-2-11-12(14(22)20-10-3-4-23-7-10)6-21(13(11)5-9)8-15(17,18)19/h1-2,5-6,10H,3-4,7-8H2,(H,20,22) |
| InChIKey | GKCMYECQUUBUJF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |