C15H19BrFNO — CID 64722332
4-bromo-N-(3,5-dimethylcyclohexyl)-2-fluorobenzamide (PubChem CID 64722332) has the molecular formula C15H19BrFNO and a molecular weight of 328.23 g/mol. Its IUPAC name is 4-bromo-N-(3,5-dimethylcyclohexyl)-2-fluorobenzamide.
| Compound Name | 4-bromo-N-(3,5-dimethylcyclohexyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 64722332 |
| Molecular Formula | C15H19BrFNO |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 4-bromo-N-(3,5-dimethylcyclohexyl)-2-fluorobenzamide |
| SMILES | CC1CC(C)CC(NC(=O)c2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C15H19BrFNO/c1-9-5-10(2)7-12(6-9)18-15(19)13-4-3-11(16)8-14(13)17/h3-4,8-10,12H,5-7H2,1-2H3,(H,18,19) |
| InChIKey | DWYFKDCCRNSSOQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |