C15H18BrFO — CID 114905837
(4-bromo-2-fluorophenyl)-(3,5-dimethylcyclohexyl)methanone (PubChem CID 114905837) has the molecular formula C15H18BrFO and a molecular weight of 313.21 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)-(3,5-dimethylcyclohexyl)methanone.
| Compound Name | (4-bromo-2-fluorophenyl)-(3,5-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 114905837 |
| Molecular Formula | C15H18BrFO |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (4-bromo-2-fluorophenyl)-(3,5-dimethylcyclohexyl)methanone |
| SMILES | CC1CC(C)CC(C(=O)c2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C15H18BrFO/c1-9-5-10(2)7-11(6-9)15(18)13-4-3-12(16)8-14(13)17/h3-4,8-11H,5-7H2,1-2H3 |
| InChIKey | JKFNHRFXSLXKNA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |