C9H6BrF3O — CID 148880045
1-(4-bromo-2-fluorophenyl)-2,2-difluoropropan-1-one (PubChem CID 148880045) has the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-2,2-difluoropropan-1-one.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-2,2-difluoropropan-1-one |
|---|---|
| PubChem CID | 148880045 |
| Molecular Formula | C9H6BrF3O |
| Molecular Weight | 267.04 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-2,2-difluoropropan-1-one |
| SMILES | CC(F)(F)C(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C9H6BrF3O/c1-9(12,13)8(14)6-3-2-5(10)4-7(6)11/h2-4H,1H3 |
| InChIKey | PCWKGHJWBYGGLY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.04 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |