C11H12Br2FNO — CID 114308107
4-bromo-N-(1-bromo-2-methylpropan-2-yl)-2-fluorobenzamide (PubChem CID 114308107) has the molecular formula C11H12Br2FNO and a molecular weight of 353.03 g/mol. Its IUPAC name is 4-bromo-N-(1-bromo-2-methylpropan-2-yl)-2-fluorobenzamide.
| Compound Name | 4-bromo-N-(1-bromo-2-methylpropan-2-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 114308107 |
| Molecular Formula | C11H12Br2FNO |
| Molecular Weight | 353.03 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 4-bromo-N-(1-bromo-2-methylpropan-2-yl)-2-fluorobenzamide |
| SMILES | CC(C)(CBr)NC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H12Br2FNO/c1-11(2,6-12)15-10(16)8-4-3-7(13)5-9(8)14/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | VSXIHVPTEIWJAU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.03 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|